C29H37FN5O2+ — CID 18433304
1-cyano-3-(3,5-diacetylphenyl)-2-[3-[1-ethyl-4-[(4-fluorophenyl)methyl]piperidin-1-ium-1-yl]propyl]guanidine (PubChem CID 18433304) has the molecular formula C29H37FN5O2+ and a molecular weight of 506.65 g/mol. Its IUPAC name is 1-cyano-3-(3,5-diacetylphenyl)-2-[3-[1-ethyl-4-[(4-fluorophenyl)methyl]piperidin-1-ium-1-yl]propyl]guanidine.
| Compound Name | 1-cyano-3-(3,5-diacetylphenyl)-2-[3-[1-ethyl-4-[(4-fluorophenyl)methyl]piperidin-1-ium-1-yl]propyl]guanidine |
|---|---|
| PubChem CID | 18433304 |
| Molecular Formula | C29H37FN5O2+ |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | 1-cyano-3-(3,5-diacetylphenyl)-2-[3-[1-ethyl-4-[(4-fluorophenyl)methyl]piperidin-1-ium-1-yl]propyl]guanidine |
| SMILES | CC[N+]1(CCC/N=C(\NC#N)Nc2cc(C(C)=O)cc(C(C)=O)c2)CCC(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C29H37FN5O2/c1-4-35(14-10-24(11-15-35)16-23-6-8-27(30)9-7-23)13-5-12-32-29(33-20-31)34-28-18-25(21(2)36)17-26(19-28)22(3)37/h6-9,17-19,24H,4-5,10-16H2,1-3H3,(H2,32,33,34)/q+1 |
| InChIKey | AMPJGJOAZCFHFN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|