C29H36FN5O2 — CID 91284834
1-cyano-2-(3,5-diacetylphenyl)-1-[3-[(2S,4R)-1-ethyl-4-[(4-fluorophenyl)methyl]piperidin-2-yl]propyl]guanidine (PubChem CID 91284834) has the molecular formula C29H36FN5O2 and a molecular weight of 505.64 g/mol. Its IUPAC name is 1-cyano-2-(3,5-diacetylphenyl)-1-[3-[(2S,4R)-1-ethyl-4-[(4-fluorophenyl)methyl]piperidin-2-yl]propyl]guanidine.
| Compound Name | 1-cyano-2-(3,5-diacetylphenyl)-1-[3-[(2S,4R)-1-ethyl-4-[(4-fluorophenyl)methyl]piperidin-2-yl]propyl]guanidine |
|---|---|
| PubChem CID | 91284834 |
| Molecular Formula | C29H36FN5O2 |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | 1-cyano-2-(3,5-diacetylphenyl)-1-[3-[(2S,4R)-1-ethyl-4-[(4-fluorophenyl)methyl]piperidin-2-yl]propyl]guanidine |
| SMILES | CCN1CC[C@@H](Cc2ccc(F)cc2)C[C@@H]1CCCN(C#N)/C(N)=N/c1cc(C(C)=O)cc(C(C)=O)c1 |
| InChI | InChI=1S/C29H36FN5O2/c1-4-34-13-11-23(14-22-7-9-26(30)10-8-22)15-28(34)6-5-12-35(19-31)29(32)33-27-17-24(20(2)36)16-25(18-27)21(3)37/h7-10,16-18,23,28H,4-6,11-15H2,1-3H3,(H2,32,33)/t23-,28-/m0/s1 |
| InChIKey | MWSVHDNCPHDKIS-FIPFOOKPSA-N |
| XLogP | 5.08 |
| TPSA | 102.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|