C14H15FN2O3 — CID 167457452
2-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]-N,2-dioxoacetamide (PubChem CID 167457452) has the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. Its IUPAC name is 2-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]-N,2-dioxoacetamide.
| Compound Name | 2-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]-N,2-dioxoacetamide |
|---|---|
| PubChem CID | 167457452 |
| Molecular Formula | C14H15FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]-N,2-dioxoacetamide |
| SMILES | O=NC(=O)C(=O)N1CCC(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C14H15FN2O3/c15-12-3-1-10(2-4-12)9-11-5-7-17(8-6-11)14(19)13(18)16-20/h1-4,11H,5-9H2 |
| InChIKey | XSSLRBVJBGFQLL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|