C18H20FN3O — CID 70706949
(6-amino-3-pyridinyl)-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methanone (PubChem CID 70706949) has the molecular formula C18H20FN3O and a molecular weight of 313.38 g/mol. Its IUPAC name is (6-amino-3-pyridinyl)-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methanone.
| Compound Name | (6-amino-3-pyridinyl)-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 70706949 |
| Molecular Formula | C18H20FN3O |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | (6-amino-3-pyridinyl)-[4-[(4-fluorophenyl)methyl]piperidin-1-yl]methanone |
| SMILES | Nc1ccc(C(=O)N2CCC(Cc3ccc(F)cc3)CC2)cn1 |
| InChI | InChI=1S/C18H20FN3O/c19-16-4-1-13(2-5-16)11-14-7-9-22(10-8-14)18(23)15-3-6-17(20)21-12-15/h1-6,12,14H,7-11H2,(H2,20,21) |
| InChIKey | LVEOBCBFJZJSBS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |