C18H18FN3O2 — CID 154779989
5-[2-[(4-fluorophenyl)methyl]pyrrolidine-1-carbonyl]pyridine-2-carboxamide (PubChem CID 154779989) has the molecular formula C18H18FN3O2 and a molecular weight of 327.36 g/mol. Its IUPAC name is 5-[2-[(4-fluorophenyl)methyl]pyrrolidine-1-carbonyl]pyridine-2-carboxamide.
| Compound Name | 5-[2-[(4-fluorophenyl)methyl]pyrrolidine-1-carbonyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 154779989 |
| Molecular Formula | C18H18FN3O2 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 5-[2-[(4-fluorophenyl)methyl]pyrrolidine-1-carbonyl]pyridine-2-carboxamide |
| SMILES | NC(=O)c1ccc(C(=O)N2CCCC2Cc2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C18H18FN3O2/c19-14-6-3-12(4-7-14)10-15-2-1-9-22(15)18(24)13-5-8-16(17(20)23)21-11-13/h3-8,11,15H,1-2,9-10H2,(H2,20,23) |
| InChIKey | BJKPZOOMCFVEFL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |