C17H17FN2O — CID 84511159
[2-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]-pyridin-3-ylmethanone (PubChem CID 84511159) has the molecular formula C17H17FN2O and a molecular weight of 284.33 g/mol. Its IUPAC name is [2-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]-pyridin-3-ylmethanone.
| Compound Name | [2-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 84511159 |
| Molecular Formula | C17H17FN2O |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | [2-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1CCCC1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FN2O/c18-15-7-5-13(6-8-15)11-16-4-2-10-20(16)17(21)14-3-1-9-19-12-14/h1,3,5-9,12,16H,2,4,10-11H2 |
| InChIKey | TWZBJFFQMBENNN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |