C27H34FN5O3 — CID 70109812
[N-(3,5-diacetylphenyl)-N'-[3-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]carbamimidoyl]urea (PubChem CID 70109812) has the molecular formula C27H34FN5O3 and a molecular weight of 495.60 g/mol. Its IUPAC name is [N-(3,5-diacetylphenyl)-N'-[3-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]carbamimidoyl]urea.
| Compound Name | [N-(3,5-diacetylphenyl)-N'-[3-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]carbamimidoyl]urea |
|---|---|
| PubChem CID | 70109812 |
| Molecular Formula | C27H34FN5O3 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | [N-(3,5-diacetylphenyl)-N'-[3-[3-[(4-fluorophenyl)methyl]piperidin-1-yl]propyl]carbamimidoyl]urea |
| SMILES | CC(=O)c1cc(N/C(=N/CCCN2CCCC(Cc3ccc(F)cc3)C2)NC(N)=O)cc(C(C)=O)c1 |
| InChI | InChI=1S/C27H34FN5O3/c1-18(34)22-14-23(19(2)35)16-25(15-22)31-27(32-26(29)36)30-10-4-12-33-11-3-5-21(17-33)13-20-6-8-24(28)9-7-20/h6-9,14-16,21H,3-5,10-13,17H2,1-2H3,(H4,29,30,31,32,36) |
| InChIKey | XZDOUKBZIZTAGP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|