C29H35FN3O3+ — CID 18433313
1-(3,5-diacetylphenyl)-3-[3-[4-[(4-fluorophenyl)methyl]-1-prop-2-ynylpiperidin-1-ium-1-yl]propyl]urea (PubChem CID 18433313) has the molecular formula C29H35FN3O3+ and a molecular weight of 492.62 g/mol. Its IUPAC name is 1-(3,5-diacetylphenyl)-3-[3-[4-[(4-fluorophenyl)methyl]-1-prop-2-ynylpiperidin-1-ium-1-yl]propyl]urea.
| Compound Name | 1-(3,5-diacetylphenyl)-3-[3-[4-[(4-fluorophenyl)methyl]-1-prop-2-ynylpiperidin-1-ium-1-yl]propyl]urea |
|---|---|
| PubChem CID | 18433313 |
| Molecular Formula | C29H35FN3O3+ |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | 1-(3,5-diacetylphenyl)-3-[3-[4-[(4-fluorophenyl)methyl]-1-prop-2-ynylpiperidin-1-ium-1-yl]propyl]urea |
| SMILES | C#CC[N+]1(CCCNC(=O)Nc2cc(C(C)=O)cc(C(C)=O)c2)CCC(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C29H34FN3O3/c1-4-13-33(15-10-24(11-16-33)17-23-6-8-27(30)9-7-23)14-5-12-31-29(36)32-28-19-25(21(2)34)18-26(20-28)22(3)35/h1,6-9,18-20,24H,5,10-17H2,2-3H3,(H-,31,32,36)/p+1 |
| InChIKey | FYXSKTKUCVQCRH-UHFFFAOYSA-O |
| XLogP | 4.85 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|