C23H25FN2O3 — CID 109148460
4-N-(3-acetylphenyl)-1-N-[(4-fluorophenyl)methyl]cyclohexane-1,4-dicarboxamide (PubChem CID 109148460) has the molecular formula C23H25FN2O3 and a molecular weight of 396.46 g/mol. Its IUPAC name is 4-N-(3-acetylphenyl)-1-N-[(4-fluorophenyl)methyl]cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(3-acetylphenyl)-1-N-[(4-fluorophenyl)methyl]cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109148460 |
| Molecular Formula | C23H25FN2O3 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 4-N-(3-acetylphenyl)-1-N-[(4-fluorophenyl)methyl]cyclohexane-1,4-dicarboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)C2CCC(C(=O)NCc3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C23H25FN2O3/c1-15(27)19-3-2-4-21(13-19)26-23(29)18-9-7-17(8-10-18)22(28)25-14-16-5-11-20(24)12-6-16/h2-6,11-13,17-18H,7-10,14H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | LAJRYZAUXLVNAT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |