C24H21FN2O3 — CID 31710504
3-(cyclopropanecarbonylamino)-N-[[4-(4-fluorophenoxy)phenyl]methyl]benzamide (PubChem CID 31710504) has the molecular formula C24H21FN2O3 and a molecular weight of 404.44 g/mol. Its IUPAC name is 3-(cyclopropanecarbonylamino)-N-[[4-(4-fluorophenoxy)phenyl]methyl]benzamide.
| Compound Name | 3-(cyclopropanecarbonylamino)-N-[[4-(4-fluorophenoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 31710504 |
| Molecular Formula | C24H21FN2O3 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 3-(cyclopropanecarbonylamino)-N-[[4-(4-fluorophenoxy)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(Oc2ccc(F)cc2)cc1)c1cccc(NC(=O)C2CC2)c1 |
| InChI | InChI=1S/C24H21FN2O3/c25-19-8-12-22(13-9-19)30-21-10-4-16(5-11-21)15-26-23(28)18-2-1-3-20(14-18)27-24(29)17-6-7-17/h1-5,8-14,17H,6-7,15H2,(H,26,28)(H,27,29) |
| InChIKey | ZBRYTIVXCOKESG-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |