C23H28F3N3O — CID 22966082
1-[3-[(2R,4S)-4-benzylpiperidin-2-yl]propyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 22966082) has the molecular formula C23H28F3N3O and a molecular weight of 419.49 g/mol. Its IUPAC name is 1-[3-[(2R,4S)-4-benzylpiperidin-2-yl]propyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-[(2R,4S)-4-benzylpiperidin-2-yl]propyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 22966082 |
| Molecular Formula | C23H28F3N3O |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 1-[3-[(2R,4S)-4-benzylpiperidin-2-yl]propyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCCC[C@@H]1C[C@@H](Cc2ccccc2)CCN1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H28F3N3O/c24-23(25,26)19-8-4-9-21(16-19)29-22(30)28-12-5-10-20-15-18(11-13-27-20)14-17-6-2-1-3-7-17/h1-4,6-9,16,18,20,27H,5,10-15H2,(H2,28,29,30)/t18-,20-/m1/s1 |
| InChIKey | RTLSFIVMZRUPSU-UYAOXDASSA-N |
| XLogP | 5.22 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|