About diethyl 2-[(4-benzylpiperidin-2-yl)methyl]propanedioate;hydrochloride
diethyl 2-[(4-benzylpiperidin-2-yl)methyl]propanedioate;hydrochloride (PubChem CID 18621452) has the molecular formula C20H30ClNO4
and a molecular weight of 383.92 g/mol. Its IUPAC name is diethyl 2-[(4-benzylpiperidin-2-yl)methyl]propanedioate;hydrochloride.
Molecular Properties
| Compound Name | diethyl 2-[(4-benzylpiperidin-2-yl)methyl]propanedioate;hydrochloride |
| PubChem CID | 18621452 |
| Molecular Formula | C20H30ClNO4 |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | diethyl 2-[(4-benzylpiperidin-2-yl)methyl]propanedioate;hydrochloride |
| SMILES | CCOC(=O)C(CC1CC(Cc2ccccc2)CCN1)C(=O)OCC.Cl |
| InChI | InChI=1S/C20H29NO4.ClH/c1-3-24-19(22)18(20(23)25-4-2)14-17-13-16(10-11-21-17)12-15-8-6-5-7-9-15;/h5-9,16-18,21H,3-4,10-14H2,1-2H3;1H |
| InChIKey | YZVWYOOUQVQPGI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[(4-benzylpiperidin-2-yl)methyl]propanedioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[(4-benzylpiperidin-2-yl)methyl]propanedioate;hydrochloride?
The IUPAC name of diethyl 2-[(4-benzylpiperidin-2-yl)methyl]propanedioate;hydrochloride (CID 18621452) is diethyl 2-[(4-benzylpiperidin-2-yl)methyl]propanedioate;hydrochloride.
What is the SMILES notation for diethyl 2-[(4-benzylpiperidin-2-yl)methyl]propanedioate;hydrochloride?
The canonical SMILES for diethyl 2-[(4-benzylpiperidin-2-yl)methyl]propanedioate;hydrochloride is CCOC(=O)C(CC1CC(Cc2ccccc2)CCN1)C(=O)OCC.Cl.
What is the InChIKey of diethyl 2-[(4-benzylpiperidin-2-yl)methyl]propanedioate;hydrochloride?
The InChIKey is YZVWYOOUQVQPGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29NO4.ClH/c1-3-24-19(22)18(20(23)25-4-2)14-17-13-16(10-11-21-17)12-15-8-6-5-7-9-15;/h5-9,16-18,21H,3-4,10-14H2,1-2H3;1H.
What are the key properties of diethyl 2-[(4-benzylpiperidin-2-yl)methyl]propanedioate;hydrochloride?
diethyl 2-[(4-benzylpiperidin-2-yl)methyl]propanedioate;hydrochloride has a molecular weight of 383.92 g/mol, XLogP of 3.15, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[(4-benzylpiperidin-2-yl)methyl]propanedioate;hydrochloride is sourced from PubChem (CID 18621452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).