C27H34O2P+ — CID 71386152
5-(1-ethoxyethoxy)pentyl-triphenylphosphanium (PubChem CID 71386152) has the molecular formula C27H34O2P+ and a molecular weight of 421.54 g/mol. Its IUPAC name is 5-(1-ethoxyethoxy)pentyl-triphenylphosphanium.
| Compound Name | 5-(1-ethoxyethoxy)pentyl-triphenylphosphanium |
|---|---|
| PubChem CID | 71386152 |
| Molecular Formula | C27H34O2P+ |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 5-(1-ethoxyethoxy)pentyl-triphenylphosphanium |
| SMILES | CCOC(C)OCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H34O2P/c1-3-28-24(2)29-22-14-7-15-23-30(25-16-8-4-9-17-25,26-18-10-5-11-19-26)27-20-12-6-13-21-27/h4-6,8-13,16-21,24H,3,7,14-15,22-23H2,1-2H3/q+1 |
| InChIKey | GRSIDBJEVIOIQV-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|