C32H36O3P+ — CID 175395448
6-[1-(3,4-dihydroxyphenyl)ethoxy]hexyl-triphenylphosphanium (PubChem CID 175395448) has the molecular formula C32H36O3P+ and a molecular weight of 499.61 g/mol. Its IUPAC name is 6-[1-(3,4-dihydroxyphenyl)ethoxy]hexyl-triphenylphosphanium.
| Compound Name | 6-[1-(3,4-dihydroxyphenyl)ethoxy]hexyl-triphenylphosphanium |
|---|---|
| PubChem CID | 175395448 |
| Molecular Formula | C32H36O3P+ |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | 6-[1-(3,4-dihydroxyphenyl)ethoxy]hexyl-triphenylphosphanium |
| SMILES | CC(OCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C32H35O3P/c1-26(27-21-22-31(33)32(34)25-27)35-23-13-2-3-14-24-36(28-15-7-4-8-16-28,29-17-9-5-10-18-29)30-19-11-6-12-20-30/h4-12,15-22,25-26H,2-3,13-14,23-24H2,1H3,(H-,33,34)/p+1 |
| InChIKey | KWMVZVWCKHENRR-UHFFFAOYSA-O |
| XLogP | 6.73 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|