C15H27NOSi — CID 134942464
tert-butyl-dimethyl-[(2R)-2-methyl-3-pyridin-4-ylpropoxy]silane (PubChem CID 134942464) has the molecular formula C15H27NOSi and a molecular weight of 265.47 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2R)-2-methyl-3-pyridin-4-ylpropoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2R)-2-methyl-3-pyridin-4-ylpropoxy]silane |
|---|---|
| PubChem CID | 134942464 |
| Molecular Formula | C15H27NOSi |
| Molecular Weight | 265.47 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | tert-butyl-dimethyl-[(2R)-2-methyl-3-pyridin-4-ylpropoxy]silane |
| SMILES | C[C@@H](CO[Si](C)(C)C(C)(C)C)Cc1ccncc1 |
| InChI | InChI=1S/C15H27NOSi/c1-13(11-14-7-9-16-10-8-14)12-17-18(5,6)15(2,3)4/h7-10,13H,11-12H2,1-6H3/t13-/m1/s1 |
| InChIKey | ZFGHGOXLSUHUOC-CYBMUJFWSA-N |
| XLogP | 4.28 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|