C16H29BO4Si — CID 139806780
[4-[3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]phenoxy]boronic acid (PubChem CID 139806780) has the molecular formula C16H29BO4Si and a molecular weight of 324.30 g/mol. Its IUPAC name is [4-[3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]phenoxy]boronic acid.
| Compound Name | [4-[3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]phenoxy]boronic acid |
|---|---|
| PubChem CID | 139806780 |
| Molecular Formula | C16H29BO4Si |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | [4-[3-[tert-butyl(dimethyl)silyl]oxy-2-methylpropyl]phenoxy]boronic acid |
| SMILES | CC(CO[Si](C)(C)C(C)(C)C)Cc1ccc(OB(O)O)cc1 |
| InChI | InChI=1S/C16H29BO4Si/c1-13(12-20-22(5,6)16(2,3)4)11-14-7-9-15(10-8-14)21-17(18)19/h7-10,13,18-19H,11-12H2,1-6H3 |
| InChIKey | BWTZBESLYLXSJO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|