C13H26N2O2Si — CID 170618121
tert-butyl-dimethyl-[(2S)-2-(2-methylpyrazol-3-yl)oxypropoxy]silane (PubChem CID 170618121) has the molecular formula C13H26N2O2Si and a molecular weight of 270.45 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2S)-2-(2-methylpyrazol-3-yl)oxypropoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2S)-2-(2-methylpyrazol-3-yl)oxypropoxy]silane |
|---|---|
| PubChem CID | 170618121 |
| Molecular Formula | C13H26N2O2Si |
| Molecular Weight | 270.45 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | tert-butyl-dimethyl-[(2S)-2-(2-methylpyrazol-3-yl)oxypropoxy]silane |
| SMILES | C[C@@H](CO[Si](C)(C)C(C)(C)C)Oc1ccnn1C |
| InChI | InChI=1S/C13H26N2O2Si/c1-11(17-12-8-9-14-15(12)5)10-16-18(6,7)13(2,3)4/h8-9,11H,10H2,1-7H3/t11-/m0/s1 |
| InChIKey | RESHHZNIRFAZSC-NSHDSACASA-N |
| XLogP | 3.21 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|