C19H28N2O4SSi — CID 87250925
2-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]oxy-5-hydroxy-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 87250925) has the molecular formula C19H28N2O4SSi and a molecular weight of 408.60 g/mol. Its IUPAC name is 2-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]oxy-5-hydroxy-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]oxy-5-hydroxy-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 87250925 |
| Molecular Formula | C19H28N2O4SSi |
| Molecular Weight | 408.60 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 2-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]oxy-5-hydroxy-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | C[C@@H](CO[Si](C)(C)C(C)(C)C)Oc1ccc(O)cc1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C19H28N2O4SSi/c1-13(12-24-27(5,6)19(2,3)4)25-16-8-7-14(22)11-15(16)17(23)21-18-20-9-10-26-18/h7-11,13,22H,12H2,1-6H3,(H,20,21,23)/t13-/m0/s1 |
| InChIKey | XGQGAKLNPBYJBV-ZDUSSCGKSA-N |
| XLogP | 4.89 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|