C12H22O4 — CID 102096483
(1S,3aS,4S,6aS)-4-(2-methoxyethoxymethoxy)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-ol (PubChem CID 102096483) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is (1S,3aS,4S,6aS)-4-(2-methoxyethoxymethoxy)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-ol.
| Compound Name | (1S,3aS,4S,6aS)-4-(2-methoxyethoxymethoxy)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-ol |
|---|---|
| PubChem CID | 102096483 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (1S,3aS,4S,6aS)-4-(2-methoxyethoxymethoxy)-1,2,3,3a,4,5,6,6a-octahydropentalen-1-ol |
| SMILES | COCCOCO[C@H]1CC[C@H]2[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C12H22O4/c1-14-6-7-15-8-16-12-5-3-9-10(12)2-4-11(9)13/h9-13H,2-8H2,1H3/t9-,10-,11-,12-/m0/s1 |
| InChIKey | OKSQYZDJWWYIPG-BJDJZHNGSA-N |
| XLogP | 1.17 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|