C11H16O5S4 — CID 10784503
(6R,7R)-7-hydroxy-6-(2-methoxyethoxymethoxy)-5,6,7,8-tetrahydro-[1,3]dithiolo[4,5-b][1,4]dithiocin-2-one (PubChem CID 10784503) has the molecular formula C11H16O5S4 and a molecular weight of 356.51 g/mol. Its IUPAC name is (6R,7R)-7-hydroxy-6-(2-methoxyethoxymethoxy)-5,6,7,8-tetrahydro-[1,3]dithiolo[4,5-b][1,4]dithiocin-2-one.
| Compound Name | (6R,7R)-7-hydroxy-6-(2-methoxyethoxymethoxy)-5,6,7,8-tetrahydro-[1,3]dithiolo[4,5-b][1,4]dithiocin-2-one |
|---|---|
| PubChem CID | 10784503 |
| Molecular Formula | C11H16O5S4 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | (6R,7R)-7-hydroxy-6-(2-methoxyethoxymethoxy)-5,6,7,8-tetrahydro-[1,3]dithiolo[4,5-b][1,4]dithiocin-2-one |
| SMILES | COCCOCO[C@H]1CSc2sc(=O)sc2SC[C@@H]1O |
| InChI | InChI=1S/C11H16O5S4/c1-14-2-3-15-6-16-8-5-18-10-9(17-4-7(8)12)19-11(13)20-10/h7-8,12H,2-6H2,1H3/t7-,8-/m0/s1 |
| InChIKey | AWKAVXNXFRZDEN-YUMQZZPRSA-N |
| XLogP | 1.73 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|