C19H24Br2O7 — CID 134939415
(4S,9R,9aS)-7,9a-dibromo-9-hydroxy-8-methoxy-4-(2-methoxyethoxymethoxy)-6-methyl-3,4,4a,9-tetrahydro-2H-xanthen-1-one (PubChem CID 134939415) has the molecular formula C19H24Br2O7 and a molecular weight of 524.20 g/mol. Its IUPAC name is (4S,9R,9aS)-7,9a-dibromo-9-hydroxy-8-methoxy-4-(2-methoxyethoxymethoxy)-6-methyl-3,4,4a,9-tetrahydro-2H-xanthen-1-one.
| Compound Name | (4S,9R,9aS)-7,9a-dibromo-9-hydroxy-8-methoxy-4-(2-methoxyethoxymethoxy)-6-methyl-3,4,4a,9-tetrahydro-2H-xanthen-1-one |
|---|---|
| PubChem CID | 134939415 |
| Molecular Formula | C19H24Br2O7 |
| Molecular Weight | 524.20 g/mol |
| Exact Mass | 521.99 |
| IUPAC Name | (4S,9R,9aS)-7,9a-dibromo-9-hydroxy-8-methoxy-4-(2-methoxyethoxymethoxy)-6-methyl-3,4,4a,9-tetrahydro-2H-xanthen-1-one |
| SMILES | COCCOCO[C@H]1CCC(=O)[C@@]2(Br)C1Oc1cc(C)c(Br)c(OC)c1[C@H]2O |
| InChI | InChI=1S/C19H24Br2O7/c1-10-8-12-14(16(25-3)15(10)20)17(23)19(21)13(22)5-4-11(18(19)28-12)27-9-26-7-6-24-2/h8,11,17-18,23H,4-7,9H2,1-3H3/t11-,17+,18?,19-/m0/s1 |
| InChIKey | ULFYVYLJMDPHGD-XIPIZGTQSA-N |
| XLogP | 3.06 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.20 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|