C9H13F3O5 — CID 102355572
(4S,5R)-4-(2-methoxyethoxymethoxy)-5-(trifluoromethyl)oxolan-2-one (PubChem CID 102355572) has the molecular formula C9H13F3O5 and a molecular weight of 258.19 g/mol. Its IUPAC name is (4S,5R)-4-(2-methoxyethoxymethoxy)-5-(trifluoromethyl)oxolan-2-one.
| Compound Name | (4S,5R)-4-(2-methoxyethoxymethoxy)-5-(trifluoromethyl)oxolan-2-one |
|---|---|
| PubChem CID | 102355572 |
| Molecular Formula | C9H13F3O5 |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | (4S,5R)-4-(2-methoxyethoxymethoxy)-5-(trifluoromethyl)oxolan-2-one |
| SMILES | COCCOCO[C@H]1CC(=O)O[C@H]1C(F)(F)F |
| InChI | InChI=1S/C9H13F3O5/c1-14-2-3-15-5-16-6-4-7(13)17-8(6)9(10,11)12/h6,8H,2-5H2,1H3/t6-,8+/m0/s1 |
| InChIKey | VZTFJQFEYHACBT-POYBYMJQSA-N |
| XLogP | 0.87 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|