C23H34O7 — CID 11015361
(1S,4S,6S,7R,9R,10S,12S,13R,14R,15S,16S)-10-hydroxy-7-(2-methoxyethoxymethoxy)-12,14-dimethyl-3-oxapentacyclo[11.3.2.04,16.06,15.09,14]octadecane-2,17-dione (PubChem CID 11015361) has the molecular formula C23H34O7 and a molecular weight of 422.52 g/mol. Its IUPAC name is (1S,4S,6S,7R,9R,10S,12S,13R,14R,15S,16S)-10-hydroxy-7-(2-methoxyethoxymethoxy)-12,14-dimethyl-3-oxapentacyclo[11.3.2.04,16.06,15.09,14]octadecane-2,17-dione.
| Compound Name | (1S,4S,6S,7R,9R,10S,12S,13R,14R,15S,16S)-10-hydroxy-7-(2-methoxyethoxymethoxy)-12,14-dimethyl-3-oxapentacyclo[11.3.2.04,16.06,15.09,14]octadecane-2,17-dione |
|---|---|
| PubChem CID | 11015361 |
| Molecular Formula | C23H34O7 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | (1S,4S,6S,7R,9R,10S,12S,13R,14R,15S,16S)-10-hydroxy-7-(2-methoxyethoxymethoxy)-12,14-dimethyl-3-oxapentacyclo[11.3.2.04,16.06,15.09,14]octadecane-2,17-dione |
| SMILES | COCCOCO[C@@H]1C[C@H]2[C@@H](O)C[C@H](C)[C@H]3CC(=O)[C@H]4C(=O)O[C@H]5C[C@H]1[C@@H]([C@@H]45)[C@@]32C |
| InChI | InChI=1S/C23H34O7/c1-11-6-15(24)14-9-17(29-10-28-5-4-27-3)12-7-18-20-19(22(26)30-18)16(25)8-13(11)23(14,2)21(12)20/h11-15,17-21,24H,4-10H2,1-3H3/t11-,12+,13+,14-,15-,17+,18-,19+,20+,21-,23-/m0/s1 |
| InChIKey | NLQGXCJOCAZKFL-DQJKKVSMSA-N |
| XLogP | 1.80 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|