C20H28O6S8 — CID 10746456
(6R,7R)-2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-6,7-bis(2-methoxyethoxymethoxy)-5,6,7,8-tetrahydro-[1,3]dithiolo[4,5-b][1,4]dithiocine (PubChem CID 10746456) has the molecular formula C20H28O6S8 and a molecular weight of 620.97 g/mol. Its IUPAC name is (6R,7R)-2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-6,7-bis(2-methoxyethoxymethoxy)-5,6,7,8-tetrahydro-[1,3]dithiolo[4,5-b][1,4]dithiocine.
| Compound Name | (6R,7R)-2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-6,7-bis(2-methoxyethoxymethoxy)-5,6,7,8-tetrahydro-[1,3]dithiolo[4,5-b][1,4]dithiocine |
|---|---|
| PubChem CID | 10746456 |
| Molecular Formula | C20H28O6S8 |
| Molecular Weight | 620.97 g/mol |
| Exact Mass | 619.97 |
| IUPAC Name | (6R,7R)-2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-6,7-bis(2-methoxyethoxymethoxy)-5,6,7,8-tetrahydro-[1,3]dithiolo[4,5-b][1,4]dithiocine |
| SMILES | COCCOCO[C@H]1CSC2=C(SC[C@@H]1OCOCCOC)SC(=C1SC3=C(SCCS3)S1)S2 |
| InChI | InChI=1S/C20H28O6S8/c1-21-3-5-23-11-25-13-9-29-17-18(30-10-14(13)26-12-24-6-4-22-2)34-20(33-17)19-31-15-16(32-19)28-8-7-27-15/h13-14H,3-12H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | QAGHPJMBMMOWGI-KBPBESRZSA-N |
| XLogP | 6.30 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.97 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|