C12H20O3 — CID 134895911
cis-(1R,2S)-1-ethynyl-2-(2-methoxyethoxymethoxy)cyclohexane (PubChem CID 134895911) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is cis-(1R,2S)-1-ethynyl-2-(2-methoxyethoxymethoxy)cyclohexane.
| Compound Name | cis-(1R,2S)-1-ethynyl-2-(2-methoxyethoxymethoxy)cyclohexane |
|---|---|
| PubChem CID | 134895911 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | cis-(1R,2S)-1-ethynyl-2-(2-methoxyethoxymethoxy)cyclohexane |
| SMILES | C#C[C@H]1CCCC[C@@H]1OCOCCOC |
| InChI | InChI=1S/C12H20O3/c1-3-11-6-4-5-7-12(11)15-10-14-9-8-13-2/h1,11-12H,4-10H2,2H3/t11-,12-/m0/s1 |
| InChIKey | BAFURDBLOQGNLG-RYUDHWBXSA-N |
| XLogP | 1.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|