C12H22O4 — CID 101178614
2-[(1S,2S)-2-(2-methoxyethoxymethoxy)cyclohexyl]acetaldehyde (PubChem CID 101178614) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is 2-[(1S,2S)-2-(2-methoxyethoxymethoxy)cyclohexyl]acetaldehyde.
| Compound Name | 2-[(1S,2S)-2-(2-methoxyethoxymethoxy)cyclohexyl]acetaldehyde |
|---|---|
| PubChem CID | 101178614 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2-[(1S,2S)-2-(2-methoxyethoxymethoxy)cyclohexyl]acetaldehyde |
| SMILES | COCCOCO[C@H]1CCCC[C@H]1CC=O |
| InChI | InChI=1S/C12H22O4/c1-14-8-9-15-10-16-12-5-3-2-4-11(12)6-7-13/h7,11-12H,2-6,8-10H2,1H3/t11-,12-/m0/s1 |
| InChIKey | CPNXSOBMWUTLAO-RYUDHWBXSA-N |
| XLogP | 1.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|