[2-(2-oxoethyl)cyclohexyl] nitrate

C8H13NO4 — CID 173397282

IUPAC[2-(2-oxoethyl)cyclohexyl] nitrate
SMILESO=CCC1CCCCC1O[N+](=O)[O-]
InChIInChI=1S/C8H13NO4/c10-6-5-7-3-1-2-4-8(7)13-9(11)12/h6-8H,1-5H2
InChIKeyNYNDUNKOVGIUKR-UHFFFAOYSA-N
MW187.19 g/mol
LogP1.34
Rot. Bonds4

About [2-(2-oxoethyl)cyclohexyl] nitrate

[2-(2-oxoethyl)cyclohexyl] nitrate (PubChem CID 173397282) has the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. Its IUPAC name is [2-(2-oxoethyl)cyclohexyl] nitrate.

Molecular Properties

Compound Name[2-(2-oxoethyl)cyclohexyl] nitrate
PubChem CID173397282
Molecular FormulaC8H13NO4
Molecular Weight187.19 g/mol
Exact Mass187.08
IUPAC Name[2-(2-oxoethyl)cyclohexyl] nitrate
SMILESO=CCC1CCCCC1O[N+](=O)[O-]
InChIInChI=1S/C8H13NO4/c10-6-5-7-3-1-2-4-8(7)13-9(11)12/h6-8H,1-5H2
InChIKeyNYNDUNKOVGIUKR-UHFFFAOYSA-N
XLogP1.34
TPSA69.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.19
LogP ≤ 51.34
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze [2-(2-oxoethyl)cyclohexyl] nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(2-oxoethyl)cyclohexyl] nitrate?
The IUPAC name of [2-(2-oxoethyl)cyclohexyl] nitrate (CID 173397282) is [2-(2-oxoethyl)cyclohexyl] nitrate.
What is the SMILES notation for [2-(2-oxoethyl)cyclohexyl] nitrate?
The canonical SMILES for [2-(2-oxoethyl)cyclohexyl] nitrate is O=CCC1CCCCC1O[N+](=O)[O-].
What is the InChIKey of [2-(2-oxoethyl)cyclohexyl] nitrate?
The InChIKey is NYNDUNKOVGIUKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO4/c10-6-5-7-3-1-2-4-8(7)13-9(11)12/h6-8H,1-5H2.
What are the key properties of [2-(2-oxoethyl)cyclohexyl] nitrate?
[2-(2-oxoethyl)cyclohexyl] nitrate has a molecular weight of 187.19 g/mol, XLogP of 1.34, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-oxoethyl)cyclohexyl] nitrate is sourced from PubChem (CID 173397282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).