C15H28O4 — CID 14717259
[(1S,2S,3R)-3-(2-methoxyethoxymethoxy)-2-[(Z)-pent-2-enyl]cyclopentyl]methanol (PubChem CID 14717259) has the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. Its IUPAC name is [(1S,2S,3R)-3-(2-methoxyethoxymethoxy)-2-[(Z)-pent-2-enyl]cyclopentyl]methanol.
| Compound Name | [(1S,2S,3R)-3-(2-methoxyethoxymethoxy)-2-[(Z)-pent-2-enyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 14717259 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | [(1S,2S,3R)-3-(2-methoxyethoxymethoxy)-2-[(Z)-pent-2-enyl]cyclopentyl]methanol |
| SMILES | CC/C=C\C[C@H]1[C@@H](CO)CC[C@H]1OCOCCOC |
| InChI | InChI=1S/C15H28O4/c1-3-4-5-6-14-13(11-16)7-8-15(14)19-12-18-10-9-17-2/h4-5,13-16H,3,6-12H2,1-2H3/b5-4-/t13-,14+,15-/m1/s1 |
| InChIKey | QLGXLRWIVSLXIR-JXHPXPKJSA-N |
| XLogP | 2.37 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|