About 2-[(1R,2S,3R)-3-(2-methoxyethoxymethoxy)-2-(2-phenylmethoxyethyl)cyclopentyl]acetonitrile
2-[(1R,2S,3R)-3-(2-methoxyethoxymethoxy)-2-(2-phenylmethoxyethyl)cyclopentyl]acetonitrile (PubChem CID 11791962) has the molecular formula C20H29NO4
and a molecular weight of 347.45 g/mol. Its IUPAC name is 2-[(1R,2S,3R)-3-(2-methoxyethoxymethoxy)-2-(2-phenylmethoxyethyl)cyclopentyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[(1R,2S,3R)-3-(2-methoxyethoxymethoxy)-2-(2-phenylmethoxyethyl)cyclopentyl]acetonitrile |
| PubChem CID | 11791962 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 2-[(1R,2S,3R)-3-(2-methoxyethoxymethoxy)-2-(2-phenylmethoxyethyl)cyclopentyl]acetonitrile |
| SMILES | COCCOCO[C@@H]1CC[C@H](CC#N)[C@@H]1CCOCc1ccccc1 |
| InChI | InChI=1S/C20H29NO4/c1-22-13-14-24-16-25-20-8-7-18(9-11-21)19(20)10-12-23-15-17-5-3-2-4-6-17/h2-6,18-20H,7-10,12-16H2,1H3/t18-,19+,20-/m1/s1 |
| InChIKey | AOHQCCUTJWOHOQ-HSALFYBXSA-N |
| XLogP | 3.54 |
| TPSA | 60.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R,2S,3R)-3-(2-methoxyethoxymethoxy)-2-(2-phenylmethoxyethyl)cyclopentyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,2S,3R)-3-(2-methoxyethoxymethoxy)-2-(2-phenylmethoxyethyl)cyclopentyl]acetonitrile?
The IUPAC name of 2-[(1R,2S,3R)-3-(2-methoxyethoxymethoxy)-2-(2-phenylmethoxyethyl)cyclopentyl]acetonitrile (CID 11791962) is 2-[(1R,2S,3R)-3-(2-methoxyethoxymethoxy)-2-(2-phenylmethoxyethyl)cyclopentyl]acetonitrile.
What is the SMILES notation for 2-[(1R,2S,3R)-3-(2-methoxyethoxymethoxy)-2-(2-phenylmethoxyethyl)cyclopentyl]acetonitrile?
The canonical SMILES for 2-[(1R,2S,3R)-3-(2-methoxyethoxymethoxy)-2-(2-phenylmethoxyethyl)cyclopentyl]acetonitrile is COCCOCO[C@@H]1CC[C@H](CC#N)[C@@H]1CCOCc1ccccc1.
What is the InChIKey of 2-[(1R,2S,3R)-3-(2-methoxyethoxymethoxy)-2-(2-phenylmethoxyethyl)cyclopentyl]acetonitrile?
The InChIKey is AOHQCCUTJWOHOQ-HSALFYBXSA-N. The full InChI is InChI=1S/C20H29NO4/c1-22-13-14-24-16-25-20-8-7-18(9-11-21)19(20)10-12-23-15-17-5-3-2-4-6-17/h2-6,18-20H,7-10,12-16H2,1H3/t18-,19+,20-/m1/s1.
What are the key properties of 2-[(1R,2S,3R)-3-(2-methoxyethoxymethoxy)-2-(2-phenylmethoxyethyl)cyclopentyl]acetonitrile?
2-[(1R,2S,3R)-3-(2-methoxyethoxymethoxy)-2-(2-phenylmethoxyethyl)cyclopentyl]acetonitrile has a molecular weight of 347.45 g/mol, XLogP of 3.54, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,2S,3R)-3-(2-methoxyethoxymethoxy)-2-(2-phenylmethoxyethyl)cyclopentyl]acetonitrile is sourced from PubChem (CID 11791962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).