C33H54O7 — CID 11753345
3-[(2S,4R,6R)-6-[(2S)-3-[(2R,3S,6S)-6-[(E,2R)-2-hydroxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]-2-methoxypropyl]-4-phenylmethoxyoxan-2-yl]propane-1,2-diol (PubChem CID 11753345) has the molecular formula C33H54O7 and a molecular weight of 562.79 g/mol. Its IUPAC name is 3-[(2S,4R,6R)-6-[(2S)-3-[(2R,3S,6S)-6-[(E,2R)-2-hydroxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]-2-methoxypropyl]-4-phenylmethoxyoxan-2-yl]propane-1,2-diol.
| Compound Name | 3-[(2S,4R,6R)-6-[(2S)-3-[(2R,3S,6S)-6-[(E,2R)-2-hydroxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]-2-methoxypropyl]-4-phenylmethoxyoxan-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 11753345 |
| Molecular Formula | C33H54O7 |
| Molecular Weight | 562.79 g/mol |
| Exact Mass | 562.39 |
| IUPAC Name | 3-[(2S,4R,6R)-6-[(2S)-3-[(2R,3S,6S)-6-[(E,2R)-2-hydroxy-6-methylhept-3-enyl]-3-methyloxan-2-yl]-2-methoxypropyl]-4-phenylmethoxyoxan-2-yl]propane-1,2-diol |
| SMILES | CO[C@@H](C[C@@H]1C[C@H](OCc2ccccc2)C[C@H](CC(O)CO)O1)C[C@H]1O[C@H](C[C@@H](O)/C=C/CC(C)C)CC[C@@H]1C |
| InChI | InChI=1S/C33H54O7/c1-23(2)9-8-12-26(35)15-28-14-13-24(3)33(40-28)20-29(37-4)17-32-19-30(18-31(39-32)16-27(36)21-34)38-22-25-10-6-5-7-11-25/h5-8,10-12,23-24,26-36H,9,13-22H2,1-4H3/b12-8+/t24-,26-,27?,28-,29-,30+,31-,32+,33+/m0/s1 |
| InChIKey | BXOMKLMGPQISHE-NGJQQUNTSA-N |
| XLogP | 5.19 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.79 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|