C37H44O9SSi — CID 169247002
[(2R,3S,4S,5R,6R)-4,5-dibenzoyloxy-6-[2-[tert-butyl(dimethyl)silyl]oxybut-3-enylsulfanyl]-2-(hydroxymethyl)oxan-3-yl] benzoate (PubChem CID 169247002) has the molecular formula C37H44O9SSi and a molecular weight of 692.90 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-4,5-dibenzoyloxy-6-[2-[tert-butyl(dimethyl)silyl]oxybut-3-enylsulfanyl]-2-(hydroxymethyl)oxan-3-yl] benzoate.
| Compound Name | [(2R,3S,4S,5R,6R)-4,5-dibenzoyloxy-6-[2-[tert-butyl(dimethyl)silyl]oxybut-3-enylsulfanyl]-2-(hydroxymethyl)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 169247002 |
| Molecular Formula | C37H44O9SSi |
| Molecular Weight | 692.90 g/mol |
| Exact Mass | 692.25 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-4,5-dibenzoyloxy-6-[2-[tert-butyl(dimethyl)silyl]oxybut-3-enylsulfanyl]-2-(hydroxymethyl)oxan-3-yl] benzoate |
| SMILES | C=CC(CS[C@H]1O[C@H](CO)[C@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H44O9SSi/c1-7-28(46-48(5,6)37(2,3)4)24-47-36-32(45-35(41)27-21-15-10-16-22-27)31(44-34(40)26-19-13-9-14-20-26)30(29(23-38)42-36)43-33(39)25-17-11-8-12-18-25/h7-22,28-32,36,38H,1,23-24H2,2-6H3/t28?,29-,30+,31+,32-,36-/m1/s1 |
| InChIKey | VPLSXBJESCMZNS-MQKNDNOZSA-N |
| XLogP | 6.69 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.90 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|