C42H53NO9S2Si — CID 169246921
[(2R,3S,4S,5R,6R)-4,5-dibenzoyloxy-6-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]but-3-enylsulfanyl]-2-[(E)-[(R)-tert-butylsulfinyl]iminomethyl]oxan-3-yl] benzoate (PubChem CID 169246921) has the molecular formula C42H53NO9S2Si and a molecular weight of 808.10 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-4,5-dibenzoyloxy-6-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]but-3-enylsulfanyl]-2-[(E)-[(R)-tert-butylsulfinyl]iminomethyl]oxan-3-yl] benzoate.
| Compound Name | [(2R,3S,4S,5R,6R)-4,5-dibenzoyloxy-6-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]but-3-enylsulfanyl]-2-[(E)-[(R)-tert-butylsulfinyl]iminomethyl]oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 169246921 |
| Molecular Formula | C42H53NO9S2Si |
| Molecular Weight | 808.10 g/mol |
| Exact Mass | 807.29 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-4,5-dibenzoyloxy-6-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]but-3-enylsulfanyl]-2-[(E)-[(R)-tert-butylsulfinyl]iminomethyl]oxan-3-yl] benzoate |
| SMILES | C=CC(CO[Si](C)(C)C(C)(C)C)CS[C@H]1O[C@H](/C=N/[S@](=O)C(C)(C)C)[C@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C42H53NO9S2Si/c1-10-29(27-48-55(8,9)42(5,6)7)28-53-40-36(52-39(46)32-24-18-13-19-25-32)35(51-38(45)31-22-16-12-17-23-31)34(50-37(44)30-20-14-11-15-21-30)33(49-40)26-43-54(47)41(2,3)4/h10-26,29,33-36,40H,1,27-28H2,2-9H3/b43-26+/t29?,33-,34+,35+,36-,40-,54-/m1/s1 |
| InChIKey | NQDSAIDAQOTNGW-GRARAWPOSA-N |
| XLogP | 8.48 |
| TPSA | 126.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.10 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|