C34H35NO8S2 — CID 174147459
tert-butyl-oxido-[(3,4,5-tribenzoyloxy-6-prop-2-enylsulfanyloxan-2-yl)methylideneamino]sulfanium (PubChem CID 174147459) has the molecular formula C34H35NO8S2 and a molecular weight of 649.79 g/mol. Its IUPAC name is tert-butyl-oxido-[(3,4,5-tribenzoyloxy-6-prop-2-enylsulfanyloxan-2-yl)methylideneamino]sulfanium.
| Compound Name | tert-butyl-oxido-[(3,4,5-tribenzoyloxy-6-prop-2-enylsulfanyloxan-2-yl)methylideneamino]sulfanium |
|---|---|
| PubChem CID | 174147459 |
| Molecular Formula | C34H35NO8S2 |
| Molecular Weight | 649.79 g/mol |
| Exact Mass | 649.18 |
| IUPAC Name | tert-butyl-oxido-[(3,4,5-tribenzoyloxy-6-prop-2-enylsulfanyloxan-2-yl)methylideneamino]sulfanium |
| SMILES | C=CCSC1OC(C=N[S+]([O-])C(C)(C)C)C(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C34H35NO8S2/c1-5-21-44-33-29(43-32(38)25-19-13-8-14-20-25)28(42-31(37)24-17-11-7-12-18-24)27(41-30(36)23-15-9-6-10-16-23)26(40-33)22-35-45(39)34(2,3)4/h5-20,22,26-29,33H,1,21H2,2-4H3 |
| InChIKey | MWKCJHYLZOXEID-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 123.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.79 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|