C22H38O4 — CID 53248568
(3S,4R,5R,6S,7S,8R)-3-methoxy-4,6,8-trimethyl-1-phenylmethoxyundecane-5,7-diol (PubChem CID 53248568) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is (3S,4R,5R,6S,7S,8R)-3-methoxy-4,6,8-trimethyl-1-phenylmethoxyundecane-5,7-diol.
| Compound Name | (3S,4R,5R,6S,7S,8R)-3-methoxy-4,6,8-trimethyl-1-phenylmethoxyundecane-5,7-diol |
|---|---|
| PubChem CID | 53248568 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | (3S,4R,5R,6S,7S,8R)-3-methoxy-4,6,8-trimethyl-1-phenylmethoxyundecane-5,7-diol |
| SMILES | CCC[C@@H](C)[C@H](O)[C@H](C)[C@@H](O)[C@@H](C)[C@H](CCOCc1ccccc1)OC |
| InChI | InChI=1S/C22H38O4/c1-6-10-16(2)21(23)18(4)22(24)17(3)20(25-5)13-14-26-15-19-11-8-7-9-12-19/h7-9,11-12,16-18,20-24H,6,10,13-15H2,1-5H3/t16-,17+,18+,20+,21+,22+/m1/s1 |
| InChIKey | GDFBJFOOEGLALF-LHZXLZLDSA-N |
| XLogP | 4.04 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|