C16H25NO4 — CID 102080862
methyl N-[(3S,4R)-4-methoxy-6-phenylmethoxyhexan-3-yl]carbamate (PubChem CID 102080862) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is methyl N-[(3S,4R)-4-methoxy-6-phenylmethoxyhexan-3-yl]carbamate.
| Compound Name | methyl N-[(3S,4R)-4-methoxy-6-phenylmethoxyhexan-3-yl]carbamate |
|---|---|
| PubChem CID | 102080862 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | methyl N-[(3S,4R)-4-methoxy-6-phenylmethoxyhexan-3-yl]carbamate |
| SMILES | CC[C@H](NC(=O)OC)[C@@H](CCOCc1ccccc1)OC |
| InChI | InChI=1S/C16H25NO4/c1-4-14(17-16(18)20-3)15(19-2)10-11-21-12-13-8-6-5-7-9-13/h5-9,14-15H,4,10-12H2,1-3H3,(H,17,18)/t14-,15+/m0/s1 |
| InChIKey | RQLCBXWEFKVGMR-LSDHHAIUSA-N |
| XLogP | 2.74 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|