C15H20O6S — CID 10449166
methyl (E,4R)-4-methylsulfonyloxy-6-phenylmethoxyhex-2-enoate (PubChem CID 10449166) has the molecular formula C15H20O6S and a molecular weight of 328.39 g/mol. Its IUPAC name is methyl (E,4R)-4-methylsulfonyloxy-6-phenylmethoxyhex-2-enoate.
| Compound Name | methyl (E,4R)-4-methylsulfonyloxy-6-phenylmethoxyhex-2-enoate |
|---|---|
| PubChem CID | 10449166 |
| Molecular Formula | C15H20O6S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | methyl (E,4R)-4-methylsulfonyloxy-6-phenylmethoxyhex-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H](CCOCc1ccccc1)OS(C)(=O)=O |
| InChI | InChI=1S/C15H20O6S/c1-19-15(16)9-8-14(21-22(2,17)18)10-11-20-12-13-6-4-3-5-7-13/h3-9,14H,10-12H2,1-2H3/b9-8+/t14-/m0/s1 |
| InChIKey | SKBATOIHWFLDFH-VFNNOXKTSA-N |
| XLogP | 1.67 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|