About benzyl 2-methyloct-2-enoate
benzyl 2-methyloct-2-enoate (PubChem CID 154247203) has the molecular formula C16H22O2
and a molecular weight of 246.35 g/mol. Its IUPAC name is benzyl 2-methyloct-2-enoate.
Molecular Properties
| Compound Name | benzyl 2-methyloct-2-enoate |
| PubChem CID | 154247203 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | benzyl 2-methyloct-2-enoate |
| SMILES | CCCCCC=C(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H22O2/c1-3-4-5-7-10-14(2)16(17)18-13-15-11-8-6-9-12-15/h6,8-12H,3-5,7,13H2,1-2H3 |
| InChIKey | PBOPMLGBVQBSTN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-methyloct-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-methyloct-2-enoate?
The IUPAC name of benzyl 2-methyloct-2-enoate (CID 154247203) is benzyl 2-methyloct-2-enoate.
What is the SMILES notation for benzyl 2-methyloct-2-enoate?
The canonical SMILES for benzyl 2-methyloct-2-enoate is CCCCCC=C(C)C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 2-methyloct-2-enoate?
The InChIKey is PBOPMLGBVQBSTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O2/c1-3-4-5-7-10-14(2)16(17)18-13-15-11-8-6-9-12-15/h6,8-12H,3-5,7,13H2,1-2H3.
What are the key properties of benzyl 2-methyloct-2-enoate?
benzyl 2-methyloct-2-enoate has a molecular weight of 246.35 g/mol, XLogP of 4.26, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-methyloct-2-enoate is sourced from PubChem (CID 154247203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).