C22H24O5 — CID 174943617
benzyl 2-methyl-5-phenoxypent-2-enoate;prop-2-enoic acid (PubChem CID 174943617) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is benzyl 2-methyl-5-phenoxypent-2-enoate;prop-2-enoic acid.
| Compound Name | benzyl 2-methyl-5-phenoxypent-2-enoate;prop-2-enoic acid |
|---|---|
| PubChem CID | 174943617 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | benzyl 2-methyl-5-phenoxypent-2-enoate;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CC(=CCCOc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H20O3.C3H4O2/c1-16(9-8-14-21-18-12-6-3-7-13-18)19(20)22-15-17-10-4-2-5-11-17;1-2-3(4)5/h2-7,9-13H,8,14-15H2,1H3;2H,1H2,(H,4,5) |
| InChIKey | UVMZTFXVDMUTNG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|