C32H60O6Si2 — CID 123672854
(2S,9S)-10-[tert-butyl(dimethyl)silyl]oxy-1-[(4-methoxyphenyl)methoxy]-2,6-dimethyl-9-(2-trimethylsilylethoxymethoxy)dec-6-en-4-ol (PubChem CID 123672854) has the molecular formula C32H60O6Si2 and a molecular weight of 597.00 g/mol. Its IUPAC name is (2S,9S)-10-[tert-butyl(dimethyl)silyl]oxy-1-[(4-methoxyphenyl)methoxy]-2,6-dimethyl-9-(2-trimethylsilylethoxymethoxy)dec-6-en-4-ol.
| Compound Name | (2S,9S)-10-[tert-butyl(dimethyl)silyl]oxy-1-[(4-methoxyphenyl)methoxy]-2,6-dimethyl-9-(2-trimethylsilylethoxymethoxy)dec-6-en-4-ol |
|---|---|
| PubChem CID | 123672854 |
| Molecular Formula | C32H60O6Si2 |
| Molecular Weight | 597.00 g/mol |
| Exact Mass | 596.39 |
| IUPAC Name | (2S,9S)-10-[tert-butyl(dimethyl)silyl]oxy-1-[(4-methoxyphenyl)methoxy]-2,6-dimethyl-9-(2-trimethylsilylethoxymethoxy)dec-6-en-4-ol |
| SMILES | COc1ccc(COC[C@@H](C)CC(O)CC(C)=CC[C@@H](CO[Si](C)(C)C(C)(C)C)OCOCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C32H60O6Si2/c1-26(20-29(33)21-27(2)22-36-23-28-13-16-30(34-6)17-14-28)12-15-31(24-38-40(10,11)32(3,4)5)37-25-35-18-19-39(7,8)9/h12-14,16-17,27,29,31,33H,15,18-25H2,1-11H3/t27-,29?,31-/m0/s1 |
| InChIKey | SAGQYSQJCPYDDH-XTBGFXFQSA-N |
| XLogP | 8.04 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.00 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|