C28H36N2 — CID 15525887
(4R,5R)-3,6-bis(ethenyl)-4-N,5-N-bis[(1S)-1-phenylethyl]octa-1,7-diene-4,5-diamine (PubChem CID 15525887) has the molecular formula C28H36N2 and a molecular weight of 400.61 g/mol. Its IUPAC name is (4R,5R)-3,6-bis(ethenyl)-4-N,5-N-bis[(1S)-1-phenylethyl]octa-1,7-diene-4,5-diamine.
| Compound Name | (4R,5R)-3,6-bis(ethenyl)-4-N,5-N-bis[(1S)-1-phenylethyl]octa-1,7-diene-4,5-diamine |
|---|---|
| PubChem CID | 15525887 |
| Molecular Formula | C28H36N2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.29 |
| IUPAC Name | (4R,5R)-3,6-bis(ethenyl)-4-N,5-N-bis[(1S)-1-phenylethyl]octa-1,7-diene-4,5-diamine |
| SMILES | C=CC(C=C)[C@@H](N[C@@H](C)c1ccccc1)[C@H](N[C@@H](C)c1ccccc1)C(C=C)C=C |
| InChI | InChI=1S/C28H36N2/c1-7-23(8-2)27(29-21(5)25-17-13-11-14-18-25)28(24(9-3)10-4)30-22(6)26-19-15-12-16-20-26/h7-24,27-30H,1-4H2,5-6H3/t21-,22-,27+,28+/m0/s1 |
| InChIKey | WDTZQRMFENUGCY-SHRQFBHGSA-N |
| XLogP | 6.40 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|