C26H31FN2 — CID 78159070
1-(4-fluorophenyl)-1-N,2-N-bis(1-phenylethyl)butane-1,2-diamine (PubChem CID 78159070) has the molecular formula C26H31FN2 and a molecular weight of 390.55 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-1-N,2-N-bis(1-phenylethyl)butane-1,2-diamine.
| Compound Name | 1-(4-fluorophenyl)-1-N,2-N-bis(1-phenylethyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 78159070 |
| Molecular Formula | C26H31FN2 |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | 1-(4-fluorophenyl)-1-N,2-N-bis(1-phenylethyl)butane-1,2-diamine |
| SMILES | CCC(NC(C)c1ccccc1)C(NC(C)c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H31FN2/c1-4-25(28-19(2)21-11-7-5-8-12-21)26(23-15-17-24(27)18-16-23)29-20(3)22-13-9-6-10-14-22/h5-20,25-26,28-29H,4H2,1-3H3 |
| InChIKey | ALWIWUXHHLPHFE-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |