C21H36O18 — CID 129046480
1-O-(1-acetyloxy-2,3,4,5,6-pentahydroxyhexyl) 4-O-(2,3,4,5,6-pentahydroxy-1-propanoyloxyhexyl) butanedioate (PubChem CID 129046480) has the molecular formula C21H36O18 and a molecular weight of 576.50 g/mol. Its IUPAC name is 1-O-(1-acetyloxy-2,3,4,5,6-pentahydroxyhexyl) 4-O-(2,3,4,5,6-pentahydroxy-1-propanoyloxyhexyl) butanedioate.
| Compound Name | 1-O-(1-acetyloxy-2,3,4,5,6-pentahydroxyhexyl) 4-O-(2,3,4,5,6-pentahydroxy-1-propanoyloxyhexyl) butanedioate |
|---|---|
| PubChem CID | 129046480 |
| Molecular Formula | C21H36O18 |
| Molecular Weight | 576.50 g/mol |
| Exact Mass | 576.19 |
| IUPAC Name | 1-O-(1-acetyloxy-2,3,4,5,6-pentahydroxyhexyl) 4-O-(2,3,4,5,6-pentahydroxy-1-propanoyloxyhexyl) butanedioate |
| SMILES | CCC(=O)OC(OC(=O)CCC(=O)OC(OC(C)=O)C(O)C(O)C(O)C(O)CO)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C21H36O18/c1-3-11(27)37-21(19(35)17(33)15(31)10(26)7-23)39-13(29)5-4-12(28)38-20(36-8(2)24)18(34)16(32)14(30)9(25)6-22/h9-10,14-23,25-26,30-35H,3-7H2,1-2H3 |
| InChIKey | QDCAFANFPVPKDQ-UHFFFAOYSA-N |
| XLogP | -6.11 |
| TPSA | 307.50 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.50 |
| LogP ≤ 5 | -6.11 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|