C19H32O18 — CID 129023679
bis(1-acetyloxy-2,3,4,5,6-pentahydroxyhexyl) propanedioate (PubChem CID 129023679) has the molecular formula C19H32O18 and a molecular weight of 548.45 g/mol. Its IUPAC name is bis(1-acetyloxy-2,3,4,5,6-pentahydroxyhexyl) propanedioate.
| Compound Name | bis(1-acetyloxy-2,3,4,5,6-pentahydroxyhexyl) propanedioate |
|---|---|
| PubChem CID | 129023679 |
| Molecular Formula | C19H32O18 |
| Molecular Weight | 548.45 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | bis(1-acetyloxy-2,3,4,5,6-pentahydroxyhexyl) propanedioate |
| SMILES | CC(=O)OC(OC(=O)CC(=O)OC(OC(C)=O)C(O)C(O)C(O)C(O)CO)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C19H32O18/c1-6(22)34-18(16(32)14(30)12(28)8(24)4-20)36-10(26)3-11(27)37-19(35-7(2)23)17(33)15(31)13(29)9(25)5-21/h8-9,12-21,24-25,28-33H,3-5H2,1-2H3 |
| InChIKey | HNYCGZRMUURLFO-UHFFFAOYSA-N |
| XLogP | -6.89 |
| TPSA | 307.50 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.45 |
| LogP ≤ 5 | -6.89 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|