C10H20O9 — CID 159318623
2-hydroxybutanoic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 159318623) has the molecular formula C10H20O9 and a molecular weight of 284.26 g/mol. Its IUPAC name is 2-hydroxybutanoic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | 2-hydroxybutanoic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 159318623 |
| Molecular Formula | C10H20O9 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-hydroxybutanoic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | CCC(O)C(=O)O.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O6.C4H8O3/c7-1-3(9)5(11)6(12)4(10)2-8;1-2-3(5)4(6)7/h1,3-6,8-12H,2H2;3,5H,2H2,1H3,(H,6,7)/t3-,4+,5+,6+;/m0./s1 |
| InChIKey | LDLVGHUGZPTLGV-BTVCFUMJSA-N |
| XLogP | -3.54 |
| TPSA | 175.75 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|