C6H11FO5 — CID 57328319
(2S,3S,4R,5R)-2-(18F)fluoro-3,4,5,6-tetrahydroxyhexanal (PubChem CID 57328319) has the molecular formula C6H11FO5 and a molecular weight of 181.15 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-(18F)fluoro-3,4,5,6-tetrahydroxyhexanal.
| Compound Name | (2S,3S,4R,5R)-2-(18F)fluoro-3,4,5,6-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 57328319 |
| Molecular Formula | C6H11FO5 |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | (2S,3S,4R,5R)-2-(18F)fluoro-3,4,5,6-tetrahydroxyhexanal |
| SMILES | O=C[C@@H]([18F])[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H11FO5/c7-3(1-8)5(11)6(12)4(10)2-9/h1,3-6,9-12H,2H2/t3-,4-,5-,6-/m1/s1/i7-1 |
| InChIKey | AOYNUTHNTBLRMT-RBQTWWAMSA-N |
| XLogP | -2.40 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|