C26H36N6O8 — CID 10721595
[(2S,3R,4R,5S)-2,5-diazido-3,4-bis(2-methoxyethoxymethoxy)-6-phenoxyhexoxy]benzene (PubChem CID 10721595) has the molecular formula C26H36N6O8 and a molecular weight of 560.61 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-2,5-diazido-3,4-bis(2-methoxyethoxymethoxy)-6-phenoxyhexoxy]benzene.
| Compound Name | [(2S,3R,4R,5S)-2,5-diazido-3,4-bis(2-methoxyethoxymethoxy)-6-phenoxyhexoxy]benzene |
|---|---|
| PubChem CID | 10721595 |
| Molecular Formula | C26H36N6O8 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | [(2S,3R,4R,5S)-2,5-diazido-3,4-bis(2-methoxyethoxymethoxy)-6-phenoxyhexoxy]benzene |
| SMILES | COCCOCO[C@@H]([C@H](OCOCCOC)[C@H](COc1ccccc1)N=[N+]=[N-])[C@H](COc1ccccc1)N=[N+]=[N-] |
| InChI | InChI=1S/C26H36N6O8/c1-33-13-15-35-19-39-25(23(29-31-27)17-37-21-9-5-3-6-10-21)26(40-20-36-16-14-34-2)24(30-32-28)18-38-22-11-7-4-8-12-22/h3-12,23-26H,13-20H2,1-2H3/t23-,24-,25+,26+/m0/s1 |
| InChIKey | WDHUVTFYNGXKII-QEGGNFSNSA-N |
| XLogP | 4.51 |
| TPSA | 171.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|