C10H15O6P — CID 21023120
(1-methoxy-3-phenoxypropan-2-yl) dihydrogen phosphate (PubChem CID 21023120) has the molecular formula C10H15O6P and a molecular weight of 262.20 g/mol. Its IUPAC name is (1-methoxy-3-phenoxypropan-2-yl) dihydrogen phosphate.
| Compound Name | (1-methoxy-3-phenoxypropan-2-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 21023120 |
| Molecular Formula | C10H15O6P |
| Molecular Weight | 262.20 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | (1-methoxy-3-phenoxypropan-2-yl) dihydrogen phosphate |
| SMILES | COCC(COc1ccccc1)OP(=O)(O)O |
| InChI | InChI=1S/C10H15O6P/c1-14-7-10(16-17(11,12)13)8-15-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3,(H2,11,12,13) |
| InChIKey | DAOBVOXMPVOXLE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|