About (1-methoxy-3-phenoxypropan-2-yl) propane-1-sulfonate
(1-methoxy-3-phenoxypropan-2-yl) propane-1-sulfonate (PubChem CID 54119319) has the molecular formula C13H20O5S
and a molecular weight of 288.36 g/mol. Its IUPAC name is (1-methoxy-3-phenoxypropan-2-yl) propane-1-sulfonate.
Molecular Properties
| Compound Name | (1-methoxy-3-phenoxypropan-2-yl) propane-1-sulfonate |
| PubChem CID | 54119319 |
| Molecular Formula | C13H20O5S |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (1-methoxy-3-phenoxypropan-2-yl) propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)OC(COC)COc1ccccc1 |
| InChI | InChI=1S/C13H20O5S/c1-3-9-19(14,15)18-13(10-16-2)11-17-12-7-5-4-6-8-12/h4-8,13H,3,9-11H2,1-2H3 |
| InChIKey | NMNDSPGWDXMKMI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (1-methoxy-3-phenoxypropan-2-yl) propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methoxy-3-phenoxypropan-2-yl) propane-1-sulfonate?
The IUPAC name of (1-methoxy-3-phenoxypropan-2-yl) propane-1-sulfonate (CID 54119319) is (1-methoxy-3-phenoxypropan-2-yl) propane-1-sulfonate.
What is the SMILES notation for (1-methoxy-3-phenoxypropan-2-yl) propane-1-sulfonate?
The canonical SMILES for (1-methoxy-3-phenoxypropan-2-yl) propane-1-sulfonate is CCCS(=O)(=O)OC(COC)COc1ccccc1.
What is the InChIKey of (1-methoxy-3-phenoxypropan-2-yl) propane-1-sulfonate?
The InChIKey is NMNDSPGWDXMKMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O5S/c1-3-9-19(14,15)18-13(10-16-2)11-17-12-7-5-4-6-8-12/h4-8,13H,3,9-11H2,1-2H3.
What are the key properties of (1-methoxy-3-phenoxypropan-2-yl) propane-1-sulfonate?
(1-methoxy-3-phenoxypropan-2-yl) propane-1-sulfonate has a molecular weight of 288.36 g/mol, XLogP of 1.84, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methoxy-3-phenoxypropan-2-yl) propane-1-sulfonate is sourced from PubChem (CID 54119319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).