C9H12O6S — CID 162928579
[(2R)-1-hydroxy-3-phenoxypropan-2-yl] hydrogen sulfate (PubChem CID 162928579) has the molecular formula C9H12O6S and a molecular weight of 248.26 g/mol. Its IUPAC name is [(2R)-1-hydroxy-3-phenoxypropan-2-yl] hydrogen sulfate.
| Compound Name | [(2R)-1-hydroxy-3-phenoxypropan-2-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 162928579 |
| Molecular Formula | C9H12O6S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | [(2R)-1-hydroxy-3-phenoxypropan-2-yl] hydrogen sulfate |
| SMILES | O=S(=O)(O)O[C@H](CO)COc1ccccc1 |
| InChI | InChI=1S/C9H12O6S/c10-6-9(15-16(11,12)13)7-14-8-4-2-1-3-5-8/h1-5,9-10H,6-7H2,(H,11,12,13)/t9-/m1/s1 |
| InChIKey | RAUPINUSVUDZHP-SECBINFHSA-N |
| XLogP | 0.25 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|