C9H13NO11P2 — CID 88813583
[1-(4-nitrophenoxy)-3-phosphonooxypropan-2-yl] dihydrogen phosphate (PubChem CID 88813583) has the molecular formula C9H13NO11P2 and a molecular weight of 373.15 g/mol. Its IUPAC name is [1-(4-nitrophenoxy)-3-phosphonooxypropan-2-yl] dihydrogen phosphate.
| Compound Name | [1-(4-nitrophenoxy)-3-phosphonooxypropan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 88813583 |
| Molecular Formula | C9H13NO11P2 |
| Molecular Weight | 373.15 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | [1-(4-nitrophenoxy)-3-phosphonooxypropan-2-yl] dihydrogen phosphate |
| SMILES | O=[N+]([O-])c1ccc(OCC(COP(=O)(O)O)OP(=O)(O)O)cc1 |
| InChI | InChI=1S/C9H13NO11P2/c11-10(12)7-1-3-8(4-2-7)19-5-9(21-23(16,17)18)6-20-22(13,14)15/h1-4,9H,5-6H2,(H2,13,14,15)(H2,16,17,18) |
| InChIKey | FPWWTSOHHZYYLF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 185.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.15 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|